About (4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine
(4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine (PubChem CID 166901417) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is (4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | (4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine |
| PubChem CID | 166901417 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine |
| SMILES | C=CC[C@@H]1C(C)SCN1C |
| InChI | InChI=1S/C8H15NS/c1-4-5-8-7(2)10-6-9(8)3/h4,7-8H,1,5-6H2,2-3H3/t7?,8-/m1/s1 |
| InChIKey | SDZBZQAMXHFFAS-BRFYHDHCSA-N |
| XLogP | 1.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine?
The IUPAC name of (4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine (CID 166901417) is (4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine.
What is the SMILES notation for (4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine?
The canonical SMILES for (4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine is C=CC[C@@H]1C(C)SCN1C.
What is the InChIKey of (4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine?
The InChIKey is SDZBZQAMXHFFAS-BRFYHDHCSA-N. The full InChI is InChI=1S/C8H15NS/c1-4-5-8-7(2)10-6-9(8)3/h4,7-8H,1,5-6H2,2-3H3/t7?,8-/m1/s1.
What are the key properties of (4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine?
(4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine has a molecular weight of 157.28 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3,5-dimethyl-4-prop-2-enyl-1,3-thiazolidine is sourced from PubChem (CID 166901417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).