C15H8BrF6NO3 — CID 166901702
6-[(5-bromo-3-pyridinyl)oxy]-7-(difluoromethyl)-2,2,3,3-tetrafluoroindene-1,1-diol (PubChem CID 166901702) has the molecular formula C15H8BrF6NO3 and a molecular weight of 444.13 g/mol. Its IUPAC name is 6-[(5-bromo-3-pyridinyl)oxy]-7-(difluoromethyl)-2,2,3,3-tetrafluoroindene-1,1-diol.
| Compound Name | 6-[(5-bromo-3-pyridinyl)oxy]-7-(difluoromethyl)-2,2,3,3-tetrafluoroindene-1,1-diol |
|---|---|
| PubChem CID | 166901702 |
| Molecular Formula | C15H8BrF6NO3 |
| Molecular Weight | 444.13 g/mol |
| Exact Mass | 442.96 |
| IUPAC Name | 6-[(5-bromo-3-pyridinyl)oxy]-7-(difluoromethyl)-2,2,3,3-tetrafluoroindene-1,1-diol |
| SMILES | OC1(O)c2c(ccc(Oc3cncc(Br)c3)c2C(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C15H8BrF6NO3/c16-6-3-7(5-23-4-6)26-9-2-1-8-11(10(9)12(17)18)14(24,25)15(21,22)13(8,19)20/h1-5,12,24-25H |
| InChIKey | SMVNIZBFRVPDMW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.13 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|