About trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine
trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine (PubChem CID 166901731) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine.
Molecular Properties
| Compound Name | trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine |
| PubChem CID | 166901731 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine |
| SMILES | CCNC1C[C@H](OC)[C@@H](OC)C1 |
| InChI | InChI=1S/C9H19NO2/c1-4-10-7-5-8(11-2)9(6-7)12-3/h7-10H,4-6H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | MYPJXGDMWWRUSB-IUCAKERBSA-N |
| XLogP | 0.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine?
The IUPAC name of trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine (CID 166901731) is trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine.
What is the SMILES notation for trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine?
The canonical SMILES for trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine is CCNC1C[C@H](OC)[C@@H](OC)C1.
What is the InChIKey of trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine?
The InChIKey is MYPJXGDMWWRUSB-IUCAKERBSA-N. The full InChI is InChI=1S/C9H19NO2/c1-4-10-7-5-8(11-2)9(6-7)12-3/h7-10H,4-6H2,1-3H3/t8-,9-/m0/s1.
What are the key properties of trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine?
trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine has a molecular weight of 173.26 g/mol, XLogP of 0.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3S,4S)-N-ethyl-3,4-dimethoxycyclopentan-1-amine is sourced from PubChem (CID 166901731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).