About 1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine
1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine (PubChem CID 166901738) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is 1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine.
Molecular Properties
| Compound Name | 1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine |
| PubChem CID | 166901738 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine |
| SMILES | CO[C@H]1CN(C(C)N)C[C@H]1OC |
| InChI | InChI=1S/C8H18N2O2/c1-6(9)10-4-7(11-2)8(5-10)12-3/h6-8H,4-5,9H2,1-3H3/t6?,7-,8+ |
| InChIKey | FSEPFDCXBVTZTR-IEESLHIDSA-N |
| XLogP | -0.36 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine?
The IUPAC name of 1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine (CID 166901738) is 1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine.
What is the SMILES notation for 1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine?
The canonical SMILES for 1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine is CO[C@H]1CN(C(C)N)C[C@H]1OC.
What is the InChIKey of 1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine?
The InChIKey is FSEPFDCXBVTZTR-IEESLHIDSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-6(9)10-4-7(11-2)8(5-10)12-3/h6-8H,4-5,9H2,1-3H3/t6?,7-,8+.
What are the key properties of 1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine?
1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine has a molecular weight of 174.24 g/mol, XLogP of -0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]ethanamine is sourced from PubChem (CID 166901738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).