C18H29Br — CID 166902299
7-bromo-7-methyl-2-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-1,3,5-triene (PubChem CID 166902299) has the molecular formula C18H29Br and a molecular weight of 325.33 g/mol. Its IUPAC name is 7-bromo-7-methyl-2-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-1,3,5-triene.
| Compound Name | 7-bromo-7-methyl-2-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 166902299 |
| Molecular Formula | C18H29Br |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 7-bromo-7-methyl-2-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-1,3,5-triene |
| SMILES | CC1(Br)C=CC=CC(C(CC(C)(C)C)C(C)(C)C)=C1 |
| InChI | InChI=1S/C18H29Br/c1-16(2,3)13-15(17(4,5)6)14-10-8-9-11-18(7,19)12-14/h8-12,15H,13H2,1-7H3 |
| InChIKey | CFFVCZLRJARYLU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|