About 2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine
2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine (PubChem CID 166902883) has the molecular formula C5H7ClN4
and a molecular weight of 158.59 g/mol. Its IUPAC name is 2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine |
| PubChem CID | 166902883 |
| Molecular Formula | C5H7ClN4 |
| Molecular Weight | 158.59 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | 2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine |
| SMILES | C=C(Cl)n1ncnc1NC |
| InChI | InChI=1S/C5H7ClN4/c1-4(6)10-5(7-2)8-3-9-10/h3H,1H2,2H3,(H,7,8,9) |
| InChIKey | RPHVBCNEBKMFSH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.59 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine?
The IUPAC name of 2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine (CID 166902883) is 2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine?
The canonical SMILES for 2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine is C=C(Cl)n1ncnc1NC.
What is the InChIKey of 2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine?
The InChIKey is RPHVBCNEBKMFSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN4/c1-4(6)10-5(7-2)8-3-9-10/h3H,1H2,2H3,(H,7,8,9).
What are the key properties of 2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine?
2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine has a molecular weight of 158.59 g/mol, XLogP of 0.99, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloroethenyl)-N-methyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 166902883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).