C18H31N3 — CID 166904451
(1Z)-2-N-[3-[[(2Z)-3-ethylpenta-2,4-dienylidene]amino]propyl]-3-methyl-2-N-propylbuta-1,3-diene-1,2-diamine (PubChem CID 166904451) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is (1Z)-2-N-[3-[[(2Z)-3-ethylpenta-2,4-dienylidene]amino]propyl]-3-methyl-2-N-propylbuta-1,3-diene-1,2-diamine.
| Compound Name | (1Z)-2-N-[3-[[(2Z)-3-ethylpenta-2,4-dienylidene]amino]propyl]-3-methyl-2-N-propylbuta-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 166904451 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | (1Z)-2-N-[3-[[(2Z)-3-ethylpenta-2,4-dienylidene]amino]propyl]-3-methyl-2-N-propylbuta-1,3-diene-1,2-diamine |
| SMILES | C=C/C(=C\C=N\CCCN(CCC)/C(=C\N)C(=C)C)CC |
| InChI | InChI=1S/C18H31N3/c1-6-13-21(18(15-19)16(4)5)14-9-11-20-12-10-17(7-2)8-3/h7,10,12,15H,2,4,6,8-9,11,13-14,19H2,1,3,5H3/b17-10+,18-15-,20-12+ |
| InChIKey | ZMGGCSSIBZIEJB-CFDUIFPWSA-N |
| XLogP | 4.06 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|