C13H24N2 — CID 166904645
2,2-dimethyl-N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]propanimidamide (PubChem CID 166904645) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 2,2-dimethyl-N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]propanimidamide.
| Compound Name | 2,2-dimethyl-N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]propanimidamide |
|---|---|
| PubChem CID | 166904645 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 2,2-dimethyl-N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]propanimidamide |
| SMILES | C=N/C(=N\C=C(/C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H24N2/c1-10(12(2,3)4)9-15-11(14-8)13(5,6)7/h9H,8H2,1-7H3/b10-9+,15-11- |
| InChIKey | UODKJPOEENOKRD-RKVFCIRRSA-N |
| XLogP | 4.08 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|