C21H25FN4O4S — CID 166904815
1-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[(6R)-6-methoxy-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]sulfinylmethyl]urea (PubChem CID 166904815) has the molecular formula C21H25FN4O4S and a molecular weight of 448.52 g/mol. Its IUPAC name is 1-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[(6R)-6-methoxy-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]sulfinylmethyl]urea.
| Compound Name | 1-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[(6R)-6-methoxy-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]sulfinylmethyl]urea |
|---|---|
| PubChem CID | 166904815 |
| Molecular Formula | C21H25FN4O4S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 1-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[(6R)-6-methoxy-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]sulfinylmethyl]urea |
| SMILES | CO[C@H]1COc2c(S(=O)CNC(=O)Nc3c4c(c(F)c5c3CCC5)CCC4)cnn2C1 |
| InChI | InChI=1S/C21H25FN4O4S/c1-29-12-9-26-20(30-10-12)17(8-24-26)31(28)11-23-21(27)25-19-15-6-2-4-13(15)18(22)14-5-3-7-16(14)19/h8,12H,2-7,9-11H2,1H3,(H2,23,25,27)/t12-,31?/m1/s1 |
| InChIKey | AZTAWTXSMZEYQH-TXCSDCKISA-N |
| XLogP | 2.29 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |