About 4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol
4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol (PubChem CID 166904960) has the molecular formula C8H12OS
and a molecular weight of 156.25 g/mol. Its IUPAC name is 4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol.
Molecular Properties
| Compound Name | 4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol |
| PubChem CID | 166904960 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol |
| SMILES | COCC1=CCC(S)C=C1 |
| InChI | InChI=1S/C8H12OS/c1-9-6-7-2-4-8(10)5-3-7/h2-4,8,10H,5-6H2,1H3 |
| InChIKey | XJBGKFRYYZUZKI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol?
The IUPAC name of 4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol (CID 166904960) is 4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol.
What is the SMILES notation for 4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol?
The canonical SMILES for 4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol is COCC1=CCC(S)C=C1.
What is the InChIKey of 4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol?
The InChIKey is XJBGKFRYYZUZKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12OS/c1-9-6-7-2-4-8(10)5-3-7/h2-4,8,10H,5-6H2,1H3.
What are the key properties of 4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol?
4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol has a molecular weight of 156.25 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methoxymethyl)cyclohexa-2,4-diene-1-thiol is sourced from PubChem (CID 166904960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).