C20H25ClF4N4O2 — CID 166905047
(4S)-N-[(3-chloro-4-fluorophenyl)-[(2S,6R)-2,6-dimethyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-2-oxoimidazolidine-4-carboxamide (PubChem CID 166905047) has the molecular formula C20H25ClF4N4O2 and a molecular weight of 464.89 g/mol. Its IUPAC name is (4S)-N-[(3-chloro-4-fluorophenyl)-[(2S,6R)-2,6-dimethyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-2-oxoimidazolidine-4-carboxamide.
| Compound Name | (4S)-N-[(3-chloro-4-fluorophenyl)-[(2S,6R)-2,6-dimethyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-2-oxoimidazolidine-4-carboxamide |
|---|---|
| PubChem CID | 166905047 |
| Molecular Formula | C20H25ClF4N4O2 |
| Molecular Weight | 464.89 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | (4S)-N-[(3-chloro-4-fluorophenyl)-[(2S,6R)-2,6-dimethyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-2-oxoimidazolidine-4-carboxamide |
| SMILES | C[C@@H]1CC(C(NC(=O)[C@@H]2CNC(=O)N2)c2ccc(F)c(Cl)c2)C[C@H](C)N1CC(F)(F)F |
| InChI | InChI=1S/C20H25ClF4N4O2/c1-10-5-13(6-11(2)29(10)9-20(23,24)25)17(12-3-4-15(22)14(21)7-12)28-18(30)16-8-26-19(31)27-16/h3-4,7,10-11,13,16-17H,5-6,8-9H2,1-2H3,(H,28,30)(H2,26,27,31)/t10-,11+,13?,16-,17?/m0/s1 |
| InChIKey | WSSIYRMASPWQMS-HPYWGUHYSA-N |
| XLogP | 3.37 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.89 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |