C10H8F6N2 — CID 166905225
(E)-6,6,6-trifluoro-3-methyl-5-(3,3,3-trifluoroprop-1-en-2-ylimino)hex-3-enenitrile (PubChem CID 166905225) has the molecular formula C10H8F6N2 and a molecular weight of 270.18 g/mol. Its IUPAC name is (E)-6,6,6-trifluoro-3-methyl-5-(3,3,3-trifluoroprop-1-en-2-ylimino)hex-3-enenitrile.
| Compound Name | (E)-6,6,6-trifluoro-3-methyl-5-(3,3,3-trifluoroprop-1-en-2-ylimino)hex-3-enenitrile |
|---|---|
| PubChem CID | 166905225 |
| Molecular Formula | C10H8F6N2 |
| Molecular Weight | 270.18 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (E)-6,6,6-trifluoro-3-methyl-5-(3,3,3-trifluoroprop-1-en-2-ylimino)hex-3-enenitrile |
| SMILES | C=C(/N=C(/C=C(\C)CC#N)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F6N2/c1-6(3-4-17)5-8(10(14,15)16)18-7(2)9(11,12)13/h5H,2-3H2,1H3/b6-5+,18-8- |
| InChIKey | JQKBACGHICRFRT-QYZIKYIRSA-N |
| XLogP | 3.93 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.18 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|