About (Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene
(Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene (PubChem CID 166905246) has the molecular formula C9H16F2O2
and a molecular weight of 194.22 g/mol. Its IUPAC name is (Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene.
Molecular Properties
| Compound Name | (Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene |
| PubChem CID | 166905246 |
| Molecular Formula | C9H16F2O2 |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene |
| SMILES | C/C=C(/C)OC(C)COC(C)(F)F |
| InChI | InChI=1S/C9H16F2O2/c1-5-7(2)13-8(3)6-12-9(4,10)11/h5,8H,6H2,1-4H3/b7-5- |
| InChIKey | RVDFAAOGLPZREF-ALCCZGGFSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene?
The IUPAC name of (Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene (CID 166905246) is (Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene.
What is the SMILES notation for (Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene?
The canonical SMILES for (Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene is C/C=C(/C)OC(C)COC(C)(F)F.
What is the InChIKey of (Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene?
The InChIKey is RVDFAAOGLPZREF-ALCCZGGFSA-N. The full InChI is InChI=1S/C9H16F2O2/c1-5-7(2)13-8(3)6-12-9(4,10)11/h5,8H,6H2,1-4H3/b7-5-.
What are the key properties of (Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene?
(Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene has a molecular weight of 194.22 g/mol, XLogP of 2.94, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[1-(1,1-difluoroethoxy)propan-2-yloxy]but-2-ene is sourced from PubChem (CID 166905246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).