About 7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium
7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium (PubChem CID 166905295) has the molecular formula C7H4ClINOS+
and a molecular weight of 312.54 g/mol. Its IUPAC name is 7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium.
Molecular Properties
| Compound Name | 7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium |
| PubChem CID | 166905295 |
| Molecular Formula | C7H4ClINOS+ |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 311.87 |
| IUPAC Name | 7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium |
| SMILES | O[n+]1ccc(Cl)c2sc(I)cc21 |
| InChI | InChI=1S/C7H4ClINOS/c8-4-1-2-10(11)5-3-6(9)12-7(4)5/h1-3,11H/q+1 |
| InChIKey | KCMWNPJJKZTNKH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium?
The IUPAC name of 7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium (CID 166905295) is 7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium.
What is the SMILES notation for 7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium?
The canonical SMILES for 7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium is O[n+]1ccc(Cl)c2sc(I)cc21.
What is the InChIKey of 7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium?
The InChIKey is KCMWNPJJKZTNKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClINOS/c8-4-1-2-10(11)5-3-6(9)12-7(4)5/h1-3,11H/q+1.
What are the key properties of 7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium?
7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium has a molecular weight of 312.54 g/mol, XLogP of 2.68, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-hydroxy-2-iodothieno[3,2-b]pyridin-4-ium is sourced from PubChem (CID 166905295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).