C19H24N4O — CID 166905323
cis-(1S,3R)-3-[[2-methyl-7-[(Z)-1-(2-methylidenehydrazinyl)prop-1-enyl]quinolin-4-yl]amino]cyclopentan-1-ol (PubChem CID 166905323) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is cis-(1S,3R)-3-[[2-methyl-7-[(Z)-1-(2-methylidenehydrazinyl)prop-1-enyl]quinolin-4-yl]amino]cyclopentan-1-ol.
| Compound Name | cis-(1S,3R)-3-[[2-methyl-7-[(Z)-1-(2-methylidenehydrazinyl)prop-1-enyl]quinolin-4-yl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 166905323 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | cis-(1S,3R)-3-[[2-methyl-7-[(Z)-1-(2-methylidenehydrazinyl)prop-1-enyl]quinolin-4-yl]amino]cyclopentan-1-ol |
| SMILES | C=NN/C(=C\C)c1ccc2c(N[C@@H]3CC[C@H](O)C3)cc(C)nc2c1 |
| InChI | InChI=1S/C19H24N4O/c1-4-17(23-20-3)13-5-8-16-18(9-12(2)21-19(16)10-13)22-14-6-7-15(24)11-14/h4-5,8-10,14-15,23-24H,3,6-7,11H2,1-2H3,(H,21,22)/b17-4-/t14-,15+/m1/s1 |
| InChIKey | OHQNVEVVZSDPSL-QTZHHJPFSA-N |
| XLogP | 3.43 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|