C16H21N7S — CID 166905401
7-N-[2-[[amino(methyl)amino]methyl]but-3-enyl]-2-(1H-pyrazol-5-yl)thieno[3,2-b]pyridine-5,7-diamine (PubChem CID 166905401) has the molecular formula C16H21N7S and a molecular weight of 343.46 g/mol. Its IUPAC name is 7-N-[2-[[amino(methyl)amino]methyl]but-3-enyl]-2-(1H-pyrazol-5-yl)thieno[3,2-b]pyridine-5,7-diamine.
| Compound Name | 7-N-[2-[[amino(methyl)amino]methyl]but-3-enyl]-2-(1H-pyrazol-5-yl)thieno[3,2-b]pyridine-5,7-diamine |
|---|---|
| PubChem CID | 166905401 |
| Molecular Formula | C16H21N7S |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 7-N-[2-[[amino(methyl)amino]methyl]but-3-enyl]-2-(1H-pyrazol-5-yl)thieno[3,2-b]pyridine-5,7-diamine |
| SMILES | C=CC(CNc1cc(N)nc2cc(-c3ccn[nH]3)sc12)CN(C)N |
| InChI | InChI=1S/C16H21N7S/c1-3-10(9-23(2)18)8-19-12-7-15(17)21-13-6-14(24-16(12)13)11-4-5-20-22-11/h3-7,10H,1,8-9,18H2,2H3,(H,20,22)(H3,17,19,21) |
| InChIKey | LRXMRUKOBNFSSJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|