C14H18FN5OS — CID 166905481
3-[[2-(4-fluoropyrazol-1-yl)-5-(methylamino)-2,3-dihydrothieno[3,2-b]pyridin-7-yl]amino]propan-1-ol (PubChem CID 166905481) has the molecular formula C14H18FN5OS and a molecular weight of 323.40 g/mol. Its IUPAC name is 3-[[2-(4-fluoropyrazol-1-yl)-5-(methylamino)-2,3-dihydrothieno[3,2-b]pyridin-7-yl]amino]propan-1-ol.
| Compound Name | 3-[[2-(4-fluoropyrazol-1-yl)-5-(methylamino)-2,3-dihydrothieno[3,2-b]pyridin-7-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 166905481 |
| Molecular Formula | C14H18FN5OS |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-[[2-(4-fluoropyrazol-1-yl)-5-(methylamino)-2,3-dihydrothieno[3,2-b]pyridin-7-yl]amino]propan-1-ol |
| SMILES | CNc1cc(NCCCO)c2c(n1)CC(n1cc(F)cn1)S2 |
| InChI | InChI=1S/C14H18FN5OS/c1-16-12-5-10(17-3-2-4-21)14-11(19-12)6-13(22-14)20-8-9(15)7-18-20/h5,7-8,13,21H,2-4,6H2,1H3,(H2,16,17,19) |
| InChIKey | NAVKFMZVQZTAIN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|