C25H37N — CID 166905484
(2E,3Z,5Z)-N-[(4E,6Z)-4-ethyl-2,3,3,5-tetramethylnona-4,6-dien-8-yn-2-yl]-2-propylidenehepta-3,5-dien-1-imine (PubChem CID 166905484) has the molecular formula C25H37N and a molecular weight of 351.58 g/mol. Its IUPAC name is (2E,3Z,5Z)-N-[(4E,6Z)-4-ethyl-2,3,3,5-tetramethylnona-4,6-dien-8-yn-2-yl]-2-propylidenehepta-3,5-dien-1-imine.
| Compound Name | (2E,3Z,5Z)-N-[(4E,6Z)-4-ethyl-2,3,3,5-tetramethylnona-4,6-dien-8-yn-2-yl]-2-propylidenehepta-3,5-dien-1-imine |
|---|---|
| PubChem CID | 166905484 |
| Molecular Formula | C25H37N |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | (2E,3Z,5Z)-N-[(4E,6Z)-4-ethyl-2,3,3,5-tetramethylnona-4,6-dien-8-yn-2-yl]-2-propylidenehepta-3,5-dien-1-imine |
| SMILES | C#C/C=C\C(C)=C(/CC)C(C)(C)C(C)(C)/N=C/C(/C=C\C=C/C)=C/CC |
| InChI | InChI=1S/C25H37N/c1-10-14-16-19-22(17-12-3)20-26-25(8,9)24(6,7)23(13-4)21(5)18-15-11-2/h2,10,14-20H,12-13H2,1,3-9H3/b14-10-,18-15-,19-16-,22-17+,23-21+,26-20+ |
| InChIKey | ZXRRRHMQBHEJTB-TUMBOHIMSA-N |
| XLogP | 7.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|