About (1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine
(1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine (PubChem CID 166906464) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is (1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine.
Molecular Properties
| Compound Name | (1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine |
| PubChem CID | 166906464 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine |
| SMILES | [H]/N=C(C=C)/C(=C\N(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H20N2/c1-7-10(12)9(8-13(5)6)11(2,3)4/h7-8,12H,1H2,2-6H3/b9-8+,12-10+ |
| InChIKey | HKYZCOKXQBVDPD-CDKJVOIVSA-N |
| XLogP | 2.68 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine?
The IUPAC name of (1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine (CID 166906464) is (1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine.
What is the SMILES notation for (1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine?
The canonical SMILES for (1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine is [H]/N=C(C=C)/C(=C\N(C)C)C(C)(C)C.
What is the InChIKey of (1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine?
The InChIKey is HKYZCOKXQBVDPD-CDKJVOIVSA-N. The full InChI is InChI=1S/C11H20N2/c1-7-10(12)9(8-13(5)6)11(2,3)4/h7-8,12H,1H2,2-6H3/b9-8+,12-10+.
What are the key properties of (1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine?
(1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine has a molecular weight of 180.29 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-2-tert-butyl-3-imino-N,N-dimethylpenta-1,4-dien-1-amine is sourced from PubChem (CID 166906464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).