C29H21Cl — CID 166906516
(10S)-2'-chloro-1',9,9-trimethylspiro[anthracene-10,9'-fluorene] (PubChem CID 166906516) has the molecular formula C29H21Cl and a molecular weight of 404.94 g/mol. Its IUPAC name is (10S)-2'-chloro-1',9,9-trimethylspiro[anthracene-10,9'-fluorene].
| Compound Name | (10S)-2'-chloro-1',9,9-trimethylspiro[anthracene-10,9'-fluorene] |
|---|---|
| PubChem CID | 166906516 |
| Molecular Formula | C29H21Cl |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (10S)-2'-chloro-1',9,9-trimethylspiro[anthracene-10,9'-fluorene] |
| SMILES | Cc1c(Cl)ccc2c1[C@]1(C3=C(C=C=C=C3)C(C)(C)c3ccccc31)c1ccccc1-2 |
| InChI | InChI=1S/C29H21Cl/c1-18-26(30)17-16-20-19-10-4-5-11-21(19)29(27(18)20)24-14-8-6-12-22(24)28(2,3)23-13-7-9-15-25(23)29/h4-6,8,10-17H,1-3H3/t29-/m1/s1 |
| InChIKey | YTAIQUBQPBNUKU-GDLZYMKVSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |