About 2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine
2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine (PubChem CID 166906814) has the molecular formula C19H38N2
and a molecular weight of 294.53 g/mol. Its IUPAC name is 2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine.
Molecular Properties
| Compound Name | 2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine |
| PubChem CID | 166906814 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | 2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine |
| SMILES | CCC(C)/C=C\CC(C)/N=C/C(C)C(C)CC(CC)CN |
| InChI | InChI=1S/C19H38N2/c1-7-15(3)10-9-11-18(6)21-14-17(5)16(4)12-19(8-2)13-20/h9-10,14-19H,7-8,11-13,20H2,1-6H3/b10-9-,21-14+ |
| InChIKey | YUZJORJUDZSGMR-NWGLWDCXSA-N |
| XLogP | 5.09 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine?
The IUPAC name of 2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine (CID 166906814) is 2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine.
What is the SMILES notation for 2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine?
The canonical SMILES for 2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine is CCC(C)/C=C\CC(C)/N=C/C(C)C(C)CC(CC)CN.
What is the InChIKey of 2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine?
The InChIKey is YUZJORJUDZSGMR-NWGLWDCXSA-N. The full InChI is InChI=1S/C19H38N2/c1-7-15(3)10-9-11-18(6)21-14-17(5)16(4)12-19(8-2)13-20/h9-10,14-19H,7-8,11-13,20H2,1-6H3/b10-9-,21-14+.
What are the key properties of 2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine?
2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine has a molecular weight of 294.53 g/mol, XLogP of 5.09, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,5-dimethyl-6-[(Z)-6-methyloct-4-en-2-yl]iminohexan-1-amine is sourced from PubChem (CID 166906814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).