About (2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine
(2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine (PubChem CID 166906830) has the molecular formula C9H15NS
and a molecular weight of 169.29 g/mol. Its IUPAC name is (2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine.
Molecular Properties
| Compound Name | (2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine |
| PubChem CID | 166906830 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine |
| SMILES | C=C(C)/C(=C\C=N\C)SCC |
| InChI | InChI=1S/C9H15NS/c1-5-11-9(8(2)3)6-7-10-4/h6-7H,2,5H2,1,3-4H3/b9-6+,10-7+ |
| InChIKey | ODXXIVPXQOAFHT-KZZDLZNXSA-N |
| XLogP | 2.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine?
The IUPAC name of (2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine (CID 166906830) is (2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine.
What is the SMILES notation for (2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine?
The canonical SMILES for (2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine is C=C(C)/C(=C\C=N\C)SCC.
What is the InChIKey of (2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine?
The InChIKey is ODXXIVPXQOAFHT-KZZDLZNXSA-N. The full InChI is InChI=1S/C9H15NS/c1-5-11-9(8(2)3)6-7-10-4/h6-7H,2,5H2,1,3-4H3/b9-6+,10-7+.
What are the key properties of (2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine?
(2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine has a molecular weight of 169.29 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3-ethylsulfanyl-N,4-dimethylpenta-2,4-dien-1-imine is sourced from PubChem (CID 166906830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).