About [3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate
[3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate (PubChem CID 166906862) has the molecular formula C19H27NO6
and a molecular weight of 365.43 g/mol. Its IUPAC name is [3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate.
Molecular Properties
| Compound Name | [3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate |
| PubChem CID | 166906862 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | [3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate |
| SMILES | C=C(C)C1CC(Oc2ccc(COC(C)=O)cc2NC)C(O)C(O)C1O |
| InChI | InChI=1S/C19H27NO6/c1-10(2)13-8-16(18(23)19(24)17(13)22)26-15-6-5-12(7-14(15)20-4)9-25-11(3)21/h5-7,13,16-20,22-24H,1,8-9H2,2-4H3 |
| InChIKey | BFZLVNNUXUYANZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate?
The IUPAC name of [3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate (CID 166906862) is [3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate.
What is the SMILES notation for [3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate?
The canonical SMILES for [3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate is C=C(C)C1CC(Oc2ccc(COC(C)=O)cc2NC)C(O)C(O)C1O.
What is the InChIKey of [3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate?
The InChIKey is BFZLVNNUXUYANZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO6/c1-10(2)13-8-16(18(23)19(24)17(13)22)26-15-6-5-12(7-14(15)20-4)9-25-11(3)21/h5-7,13,16-20,22-24H,1,8-9H2,2-4H3.
What are the key properties of [3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate?
[3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate has a molecular weight of 365.43 g/mol, XLogP of 1.22, 6 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(methylamino)-4-(2,3,4-trihydroxy-5-prop-1-en-2-ylcyclohexyl)oxyphenyl]methyl acetate is sourced from PubChem (CID 166906862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).