C12H18FNO — CID 166906897
(2Z,5E)-N-(fluoromethyl)-5-methoxy-N-methyl-4-methylideneocta-2,5,7-trien-2-amine (PubChem CID 166906897) has the molecular formula C12H18FNO and a molecular weight of 211.28 g/mol. Its IUPAC name is (2Z,5E)-N-(fluoromethyl)-5-methoxy-N-methyl-4-methylideneocta-2,5,7-trien-2-amine.
| Compound Name | (2Z,5E)-N-(fluoromethyl)-5-methoxy-N-methyl-4-methylideneocta-2,5,7-trien-2-amine |
|---|---|
| PubChem CID | 166906897 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (2Z,5E)-N-(fluoromethyl)-5-methoxy-N-methyl-4-methylideneocta-2,5,7-trien-2-amine |
| SMILES | C=C/C=C(/OC)C(=C)/C=C(/C)N(C)CF |
| InChI | InChI=1S/C12H18FNO/c1-6-7-12(15-5)10(2)8-11(3)14(4)9-13/h6-8H,1-2,9H2,3-5H3/b11-8-,12-7+ |
| InChIKey | WWSAONPOEITCDG-MVOOLVRYSA-N |
| XLogP | 3.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|