C15H21F2NO3 — CID 166907267
2-methylpropyl 3-[[(3Z,5Z)-3,4-difluoro-2-methylidenehepta-3,5-dienyl]amino]-3-oxopropanoate (PubChem CID 166907267) has the molecular formula C15H21F2NO3 and a molecular weight of 301.33 g/mol. Its IUPAC name is 2-methylpropyl 3-[[(3Z,5Z)-3,4-difluoro-2-methylidenehepta-3,5-dienyl]amino]-3-oxopropanoate.
| Compound Name | 2-methylpropyl 3-[[(3Z,5Z)-3,4-difluoro-2-methylidenehepta-3,5-dienyl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 166907267 |
| Molecular Formula | C15H21F2NO3 |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-methylpropyl 3-[[(3Z,5Z)-3,4-difluoro-2-methylidenehepta-3,5-dienyl]amino]-3-oxopropanoate |
| SMILES | C=C(CNC(=O)CC(=O)OCC(C)C)/C(F)=C(F)\C=C/C |
| InChI | InChI=1S/C15H21F2NO3/c1-5-6-12(16)15(17)11(4)8-18-13(19)7-14(20)21-9-10(2)3/h5-6,10H,4,7-9H2,1-3H3,(H,18,19)/b6-5-,15-12- |
| InChIKey | HVWFYLMJNUUBFB-JYBCYRHMSA-N |
| XLogP | 2.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|