C24H44FN3 — CID 166907304
1-tert-butyl-2-[(2E,4Z,6E)-7-fluoro-5-(3-piperidin-1-ylpropyl)octa-2,4,6-trienyl]-2-methyl-1-propylhydrazine (PubChem CID 166907304) has the molecular formula C24H44FN3 and a molecular weight of 393.64 g/mol. Its IUPAC name is 1-tert-butyl-2-[(2E,4Z,6E)-7-fluoro-5-(3-piperidin-1-ylpropyl)octa-2,4,6-trienyl]-2-methyl-1-propylhydrazine.
| Compound Name | 1-tert-butyl-2-[(2E,4Z,6E)-7-fluoro-5-(3-piperidin-1-ylpropyl)octa-2,4,6-trienyl]-2-methyl-1-propylhydrazine |
|---|---|
| PubChem CID | 166907304 |
| Molecular Formula | C24H44FN3 |
| Molecular Weight | 393.64 g/mol |
| Exact Mass | 393.35 |
| IUPAC Name | 1-tert-butyl-2-[(2E,4Z,6E)-7-fluoro-5-(3-piperidin-1-ylpropyl)octa-2,4,6-trienyl]-2-methyl-1-propylhydrazine |
| SMILES | CCCN(N(C)C/C=C/C=C(\C=C(/C)F)CCCN1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C24H44FN3/c1-7-16-28(24(3,4)5)26(6)17-12-9-14-23(21-22(2)25)15-13-20-27-18-10-8-11-19-27/h9,12,14,21H,7-8,10-11,13,15-20H2,1-6H3/b12-9+,22-21+,23-14- |
| InChIKey | ACAMDAZJJXNSEA-CLQBRRPBSA-N |
| XLogP | 5.97 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.64 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|