C14H24N2 — CID 166907305
1-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienyl]-2,2-dimethyl-1-prop-1-en-2-ylhydrazine (PubChem CID 166907305) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienyl]-2,2-dimethyl-1-prop-1-en-2-ylhydrazine.
| Compound Name | 1-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienyl]-2,2-dimethyl-1-prop-1-en-2-ylhydrazine |
|---|---|
| PubChem CID | 166907305 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1-[(2E,3Z)-2-ethylidene-5-methylhexa-3,5-dienyl]-2,2-dimethyl-1-prop-1-en-2-ylhydrazine |
| SMILES | C=C(C)/C=C\C(=C/C)CN(C(=C)C)N(C)C |
| InChI | InChI=1S/C14H24N2/c1-8-14(10-9-12(2)3)11-16(13(4)5)15(6)7/h8-10H,2,4,11H2,1,3,5-7H3/b10-9-,14-8+ |
| InChIKey | OCFXVVMVPDZVKF-SIWKXLNPSA-N |
| XLogP | 3.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|