C27H40F3N — CID 166907321
(5Z,6E)-N-[(3E,5E)-2,6-difluorohepta-1,3,5-trien-4-yl]-5-ethylidene-7-fluoro-6-methyl-3-(3,4,4-trimethylpentan-2-yl)nona-1,6,8-trien-2-amine (PubChem CID 166907321) has the molecular formula C27H40F3N and a molecular weight of 435.62 g/mol. Its IUPAC name is (5Z,6E)-N-[(3E,5E)-2,6-difluorohepta-1,3,5-trien-4-yl]-5-ethylidene-7-fluoro-6-methyl-3-(3,4,4-trimethylpentan-2-yl)nona-1,6,8-trien-2-amine.
| Compound Name | (5Z,6E)-N-[(3E,5E)-2,6-difluorohepta-1,3,5-trien-4-yl]-5-ethylidene-7-fluoro-6-methyl-3-(3,4,4-trimethylpentan-2-yl)nona-1,6,8-trien-2-amine |
|---|---|
| PubChem CID | 166907321 |
| Molecular Formula | C27H40F3N |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | (5Z,6E)-N-[(3E,5E)-2,6-difluorohepta-1,3,5-trien-4-yl]-5-ethylidene-7-fluoro-6-methyl-3-(3,4,4-trimethylpentan-2-yl)nona-1,6,8-trien-2-amine |
| SMILES | C=C/C(F)=C(C)\C(=C/C)CC(C(=C)NC(/C=C(\C)F)=C/C(=C)F)C(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C27H40F3N/c1-12-23(20(6)26(30)13-2)16-25(19(5)21(7)27(9,10)11)22(8)31-24(14-17(3)28)15-18(4)29/h12-15,19,21,25,31H,2-3,8,16H2,1,4-7,9-11H3/b18-15+,23-12-,24-14+,26-20+ |
| InChIKey | AEVHAEPWDBERQO-ZVDGQRALSA-N |
| XLogP | 9.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|