C21H22F2N2O3 — CID 166907330
methyl 1-[(2,3-difluorophenyl)methyl]-2-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methyl-6-oxo-3H-pyridazine-5-carboxylate (PubChem CID 166907330) has the molecular formula C21H22F2N2O3 and a molecular weight of 388.41 g/mol. Its IUPAC name is methyl 1-[(2,3-difluorophenyl)methyl]-2-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methyl-6-oxo-3H-pyridazine-5-carboxylate.
| Compound Name | methyl 1-[(2,3-difluorophenyl)methyl]-2-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methyl-6-oxo-3H-pyridazine-5-carboxylate |
|---|---|
| PubChem CID | 166907330 |
| Molecular Formula | C21H22F2N2O3 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | methyl 1-[(2,3-difluorophenyl)methyl]-2-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methyl-6-oxo-3H-pyridazine-5-carboxylate |
| SMILES | C=C/C=C\C=C/CN1C(C)C=C(C(=O)OC)C(=O)N1Cc1cccc(F)c1F |
| InChI | InChI=1S/C21H22F2N2O3/c1-4-5-6-7-8-12-24-15(2)13-17(21(27)28-3)20(26)25(24)14-16-10-9-11-18(22)19(16)23/h4-11,13,15H,1,12,14H2,2-3H3/b6-5-,8-7- |
| InChIKey | IZYVBPMLTYOSOK-ISTTXYCBSA-N |
| XLogP | 3.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|