C10H15F3N2 — CID 166907334
N'-[(Z)-1,1,1-trifluoro-3-methylpent-2-en-2-yl]butane-1,4-diimine (PubChem CID 166907334) has the molecular formula C10H15F3N2 and a molecular weight of 220.24 g/mol. Its IUPAC name is N'-[(Z)-1,1,1-trifluoro-3-methylpent-2-en-2-yl]butane-1,4-diimine.
| Compound Name | N'-[(Z)-1,1,1-trifluoro-3-methylpent-2-en-2-yl]butane-1,4-diimine |
|---|---|
| PubChem CID | 166907334 |
| Molecular Formula | C10H15F3N2 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N'-[(Z)-1,1,1-trifluoro-3-methylpent-2-en-2-yl]butane-1,4-diimine |
| SMILES | [H]/N=C/CC/C=N/C(=C(/C)CC)C(F)(F)F |
| InChI | InChI=1S/C10H15F3N2/c1-3-8(2)9(10(11,12)13)15-7-5-4-6-14/h6-7,14H,3-5H2,1-2H3/b9-8-,14-6+,15-7+ |
| InChIKey | HHNWTYLTOCFMKF-MXGHTANRSA-N |
| XLogP | 3.73 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|