About (E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine
(E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine (PubChem CID 166907347) has the molecular formula C10H15F3N2
and a molecular weight of 220.24 g/mol. Its IUPAC name is (E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine.
Molecular Properties
| Compound Name | (E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine |
| PubChem CID | 166907347 |
| Molecular Formula | C10H15F3N2 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine |
| SMILES | C/C=C(\N=C(C)\C(N)=C/C)C(F)(F)CF |
| InChI | InChI=1S/C10H15F3N2/c1-4-8(14)7(3)15-9(5-2)10(12,13)6-11/h4-5H,6,14H2,1-3H3/b8-4+,9-5-,15-7+ |
| InChIKey | ZLJASYCNCIZFCY-VBFSJQHPSA-N |
| XLogP | 2.82 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine?
The IUPAC name of (E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine (CID 166907347) is (E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine.
What is the SMILES notation for (E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine?
The canonical SMILES for (E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine is C/C=C(\N=C(C)\C(N)=C/C)C(F)(F)CF.
What is the InChIKey of (E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine?
The InChIKey is ZLJASYCNCIZFCY-VBFSJQHPSA-N. The full InChI is InChI=1S/C10H15F3N2/c1-4-8(14)7(3)15-9(5-2)10(12,13)6-11/h4-5H,6,14H2,1-3H3/b8-4+,9-5-,15-7+.
What are the key properties of (E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine?
(E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine has a molecular weight of 220.24 g/mol, XLogP of 2.82, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[(Z)-4,4,5-trifluoropent-2-en-3-yl]iminopent-2-en-3-amine is sourced from PubChem (CID 166907347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).