C28H50FN — CID 166907353
(3Z,8E,10Z)-5,5-diethyl-8-fluoro-N,4,7,9-tetramethyl-3-propan-2-yl-10-propylidenetetradeca-1,3,8-trien-2-amine (PubChem CID 166907353) has the molecular formula C28H50FN and a molecular weight of 419.71 g/mol. Its IUPAC name is (3Z,8E,10Z)-5,5-diethyl-8-fluoro-N,4,7,9-tetramethyl-3-propan-2-yl-10-propylidenetetradeca-1,3,8-trien-2-amine.
| Compound Name | (3Z,8E,10Z)-5,5-diethyl-8-fluoro-N,4,7,9-tetramethyl-3-propan-2-yl-10-propylidenetetradeca-1,3,8-trien-2-amine |
|---|---|
| PubChem CID | 166907353 |
| Molecular Formula | C28H50FN |
| Molecular Weight | 419.71 g/mol |
| Exact Mass | 419.39 |
| IUPAC Name | (3Z,8E,10Z)-5,5-diethyl-8-fluoro-N,4,7,9-tetramethyl-3-propan-2-yl-10-propylidenetetradeca-1,3,8-trien-2-amine |
| SMILES | C=C(NC)/C(=C(/C)C(CC)(CC)CC(C)/C(F)=C(C)\C(=C/CC)CCCC)C(C)C |
| InChI | InChI=1S/C28H50FN/c1-12-16-18-25(17-13-2)22(8)27(29)21(7)19-28(14-3,15-4)23(9)26(20(5)6)24(10)30-11/h17,20-21,30H,10,12-16,18-19H2,1-9,11H3/b25-17-,26-23-,27-22+ |
| InChIKey | XPSGXFSXHLPZEQ-QTXFFUDOSA-N |
| XLogP | 9.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.71 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|