About (E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine
(E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine (PubChem CID 166907355) has the molecular formula C12H20F2N2
and a molecular weight of 230.30 g/mol. Its IUPAC name is (E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine.
Molecular Properties
| Compound Name | (E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine |
| PubChem CID | 166907355 |
| Molecular Formula | C12H20F2N2 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | (E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine |
| SMILES | [H]/N=C(C=C)/C(=C/CCCC(C)(F)F)CCN |
| InChI | InChI=1S/C12H20F2N2/c1-3-11(16)10(7-9-15)6-4-5-8-12(2,13)14/h3,6,16H,1,4-5,7-9,15H2,2H3/b10-6+,16-11+ |
| InChIKey | INJASCDLRZRVLI-IPASCASISA-N |
| XLogP | 3.29 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine?
The IUPAC name of (E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine (CID 166907355) is (E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine.
What is the SMILES notation for (E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine?
The canonical SMILES for (E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine is [H]/N=C(C=C)/C(=C/CCCC(C)(F)F)CCN.
What is the InChIKey of (E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine?
The InChIKey is INJASCDLRZRVLI-IPASCASISA-N. The full InChI is InChI=1S/C12H20F2N2/c1-3-11(16)10(7-9-15)6-4-5-8-12(2,13)14/h3,6,16H,1,4-5,7-9,15H2,2H3/b10-6+,16-11+.
What are the key properties of (E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine?
(E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine has a molecular weight of 230.30 g/mol, XLogP of 3.29, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-8,8-difluoro-3-prop-2-enimidoylnon-3-en-1-amine is sourced from PubChem (CID 166907355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).