C15H23F2NO2 — CID 166907360
4-[2-[(1E,3Z)-5,7-difluoro-4-methylocta-1,3,5-trienoxy]ethyl]morpholine (PubChem CID 166907360) has the molecular formula C15H23F2NO2 and a molecular weight of 287.35 g/mol. Its IUPAC name is 4-[2-[(1E,3Z)-5,7-difluoro-4-methylocta-1,3,5-trienoxy]ethyl]morpholine.
| Compound Name | 4-[2-[(1E,3Z)-5,7-difluoro-4-methylocta-1,3,5-trienoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 166907360 |
| Molecular Formula | C15H23F2NO2 |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 4-[2-[(1E,3Z)-5,7-difluoro-4-methylocta-1,3,5-trienoxy]ethyl]morpholine |
| SMILES | C/C(=C/C=C/OCCN1CCOCC1)C(F)=CC(C)F |
| InChI | InChI=1S/C15H23F2NO2/c1-13(15(17)12-14(2)16)4-3-8-19-9-5-18-6-10-20-11-7-18/h3-4,8,12,14H,5-7,9-11H2,1-2H3/b8-3+,13-4-,15-12? |
| InChIKey | PKJIPSAQDNKBDI-FWEOUULRSA-N |
| XLogP | 3.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|