C21H33F — CID 166907373
(2Z,4E,6Z,8E)-4-tert-butyl-10-fluoro-9,10-dimethyl-7-methylidene-6-propylideneundeca-2,4,8-triene (PubChem CID 166907373) has the molecular formula C21H33F and a molecular weight of 304.49 g/mol. Its IUPAC name is (2Z,4E,6Z,8E)-4-tert-butyl-10-fluoro-9,10-dimethyl-7-methylidene-6-propylideneundeca-2,4,8-triene.
| Compound Name | (2Z,4E,6Z,8E)-4-tert-butyl-10-fluoro-9,10-dimethyl-7-methylidene-6-propylideneundeca-2,4,8-triene |
|---|---|
| PubChem CID | 166907373 |
| Molecular Formula | C21H33F |
| Molecular Weight | 304.49 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | (2Z,4E,6Z,8E)-4-tert-butyl-10-fluoro-9,10-dimethyl-7-methylidene-6-propylideneundeca-2,4,8-triene |
| SMILES | C=C(/C=C(\C)C(C)(C)F)C(=C\CC)/C=C(\C=C/C)C(C)(C)C |
| InChI | InChI=1S/C21H33F/c1-10-12-18(15-19(13-11-2)20(5,6)7)16(3)14-17(4)21(8,9)22/h11-15H,3,10H2,1-2,4-9H3/b13-11-,17-14+,18-12-,19-15+ |
| InChIKey | RZIKONNKJRCCMQ-QUBGCYNMSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.49 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|