C10H14F2N2 — CID 166907397
1-[(3,7-difluorocyclohepta-1,3,6-trien-1-yl)methyl]-1,2-dimethylhydrazine (PubChem CID 166907397) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is 1-[(3,7-difluorocyclohepta-1,3,6-trien-1-yl)methyl]-1,2-dimethylhydrazine.
| Compound Name | 1-[(3,7-difluorocyclohepta-1,3,6-trien-1-yl)methyl]-1,2-dimethylhydrazine |
|---|---|
| PubChem CID | 166907397 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1-[(3,7-difluorocyclohepta-1,3,6-trien-1-yl)methyl]-1,2-dimethylhydrazine |
| SMILES | CNN(C)CC1=CC(F)=CCC=C1F |
| InChI | InChI=1S/C10H14F2N2/c1-13-14(2)7-8-6-9(11)4-3-5-10(8)12/h4-6,13H,3,7H2,1-2H3 |
| InChIKey | GWYSQVFAWJGQEA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|