C22H36FN — CID 166907484
(3Z)-N-[(Z)-2-(1-fluoroethenyl)but-2-enyl]-N,4,5-trimethyl-3-prop-1-en-2-yldeca-1,3-dien-2-amine (PubChem CID 166907484) has the molecular formula C22H36FN and a molecular weight of 333.54 g/mol. Its IUPAC name is (3Z)-N-[(Z)-2-(1-fluoroethenyl)but-2-enyl]-N,4,5-trimethyl-3-prop-1-en-2-yldeca-1,3-dien-2-amine.
| Compound Name | (3Z)-N-[(Z)-2-(1-fluoroethenyl)but-2-enyl]-N,4,5-trimethyl-3-prop-1-en-2-yldeca-1,3-dien-2-amine |
|---|---|
| PubChem CID | 166907484 |
| Molecular Formula | C22H36FN |
| Molecular Weight | 333.54 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | (3Z)-N-[(Z)-2-(1-fluoroethenyl)but-2-enyl]-N,4,5-trimethyl-3-prop-1-en-2-yldeca-1,3-dien-2-amine |
| SMILES | C=C(F)/C(=C\C)CN(C)C(=C)/C(C(=C)C)=C(/C)C(C)CCCCC |
| InChI | InChI=1S/C22H36FN/c1-10-12-13-14-17(5)18(6)22(16(3)4)20(8)24(9)15-21(11-2)19(7)23/h11,17H,3,7-8,10,12-15H2,1-2,4-6,9H3/b21-11-,22-18- |
| InChIKey | PHFLGCMEHOFFOT-KKQJPEOJSA-N |
| XLogP | 6.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.54 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|