About 6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine
6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine (PubChem CID 166907521) has the molecular formula C8H9F3N2
and a molecular weight of 190.17 g/mol. Its IUPAC name is 6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine.
Molecular Properties
| Compound Name | 6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine |
| PubChem CID | 166907521 |
| Molecular Formula | C8H9F3N2 |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine |
| SMILES | C=C(C)C1=NC=NC(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H9F3N2/c1-5(2)6-3-7(8(9,10)11)13-4-12-6/h4,7H,1,3H2,2H3 |
| InChIKey | QURADUYCKGLWCK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine?
The IUPAC name of 6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine (CID 166907521) is 6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine.
What is the SMILES notation for 6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine?
The canonical SMILES for 6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine is C=C(C)C1=NC=NC(C(F)(F)F)C1.
What is the InChIKey of 6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine?
The InChIKey is QURADUYCKGLWCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2/c1-5(2)6-3-7(8(9,10)11)13-4-12-6/h4,7H,1,3H2,2H3.
What are the key properties of 6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine?
6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine has a molecular weight of 190.17 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-prop-1-en-2-yl-4-(trifluoromethyl)-4,5-dihydropyrimidine is sourced from PubChem (CID 166907521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).