C13H20F3N — CID 166907528
(E)-N-ethenyl-1,1,1-trifluoro-2,5,6-trimethyloct-2-en-4-imine (PubChem CID 166907528) has the molecular formula C13H20F3N and a molecular weight of 247.30 g/mol. Its IUPAC name is (E)-N-ethenyl-1,1,1-trifluoro-2,5,6-trimethyloct-2-en-4-imine.
| Compound Name | (E)-N-ethenyl-1,1,1-trifluoro-2,5,6-trimethyloct-2-en-4-imine |
|---|---|
| PubChem CID | 166907528 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (E)-N-ethenyl-1,1,1-trifluoro-2,5,6-trimethyloct-2-en-4-imine |
| SMILES | C=C/N=C(\C=C(/C)C(F)(F)F)C(C)C(C)CC |
| InChI | InChI=1S/C13H20F3N/c1-6-9(3)11(5)12(17-7-2)8-10(4)13(14,15)16/h7-9,11H,2,6H2,1,3-5H3/b10-8+,17-12+ |
| InChIKey | KCRUPHBIYLPXFP-WJISXQBPSA-N |
| XLogP | 4.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|