About 6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide
6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide (PubChem CID 166908582) has the molecular formula C17H19F2NO
and a molecular weight of 291.34 g/mol. Its IUPAC name is 6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide.
Molecular Properties
| Compound Name | 6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide |
| PubChem CID | 166908582 |
| Molecular Formula | C17H19F2NO |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide |
| SMILES | NC(=O)C12CC3CC(c4ccccc4)(CC1C3C(F)F)C2 |
| InChI | InChI=1S/C17H19F2NO/c18-14(19)13-10-6-16(11-4-2-1-3-5-11)8-12(13)17(7-10,9-16)15(20)21/h1-5,10,12-14H,6-9H2,(H2,20,21) |
| InChIKey | ZFLIVDSOJKHRBP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide?
The IUPAC name of 6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide (CID 166908582) is 6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide.
What is the SMILES notation for 6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide?
The canonical SMILES for 6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide is NC(=O)C12CC3CC(c4ccccc4)(CC1C3C(F)F)C2.
What is the InChIKey of 6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide?
The InChIKey is ZFLIVDSOJKHRBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F2NO/c18-14(19)13-10-6-16(11-4-2-1-3-5-11)8-12(13)17(7-10,9-16)15(20)21/h1-5,10,12-14H,6-9H2,(H2,20,21).
What are the key properties of 6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide?
6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide has a molecular weight of 291.34 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(difluoromethyl)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide is sourced from PubChem (CID 166908582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).