C34H27N3O — CID 166908782
4-(9,9-dimethylxanthen-4-yl)-2-(3-pyridin-2-ylphenyl)-3,8a-dihydroquinazoline (PubChem CID 166908782) has the molecular formula C34H27N3O and a molecular weight of 493.61 g/mol. Its IUPAC name is 4-(9,9-dimethylxanthen-4-yl)-2-(3-pyridin-2-ylphenyl)-3,8a-dihydroquinazoline.
| Compound Name | 4-(9,9-dimethylxanthen-4-yl)-2-(3-pyridin-2-ylphenyl)-3,8a-dihydroquinazoline |
|---|---|
| PubChem CID | 166908782 |
| Molecular Formula | C34H27N3O |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 4-(9,9-dimethylxanthen-4-yl)-2-(3-pyridin-2-ylphenyl)-3,8a-dihydroquinazoline |
| SMILES | CC1(C)c2ccccc2Oc2c(C3=C4C=CC=CC4N=C(c4cccc(-c5ccccn5)c4)N3)cccc21 |
| InChI | InChI=1S/C34H27N3O/c1-34(2)26-15-4-6-19-30(26)38-32-25(14-10-16-27(32)34)31-24-13-3-5-18-29(24)36-33(37-31)23-12-9-11-22(21-23)28-17-7-8-20-35-28/h3-21,29H,1-2H3,(H,36,37) |
| InChIKey | BUDNUOABXQVXGO-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |