About (3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide
(3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide (PubChem CID 166908966) has the molecular formula C22H29FN2O
and a molecular weight of 356.49 g/mol. Its IUPAC name is (3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide.
Molecular Properties
| Compound Name | (3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide |
| PubChem CID | 166908966 |
| Molecular Formula | C22H29FN2O |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | (3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide |
| SMILES | O=C(NC1CCNCC1)C12CC3CC(CF)(C1)C[C@@]3(c1ccccc1)C2 |
| InChI | InChI=1S/C22H29FN2O/c23-15-20-10-17-11-21(12-20,19(26)25-18-6-8-24-9-7-18)14-22(17,13-20)16-4-2-1-3-5-16/h1-5,17-18,24H,6-15H2,(H,25,26)/t17?,20?,21?,22-/m0/s1 |
| InChIKey | OJQZJEHHBALQFF-MUBNQFKJSA-N |
| XLogP | 3.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide?
The IUPAC name of (3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide (CID 166908966) is (3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide.
What is the SMILES notation for (3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide?
The canonical SMILES for (3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide is O=C(NC1CCNCC1)C12CC3CC(CF)(C1)C[C@@]3(c1ccccc1)C2.
What is the InChIKey of (3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide?
The InChIKey is OJQZJEHHBALQFF-MUBNQFKJSA-N. The full InChI is InChI=1S/C22H29FN2O/c23-15-20-10-17-11-21(12-20,19(26)25-18-6-8-24-9-7-18)14-22(17,13-20)16-4-2-1-3-5-16/h1-5,17-18,24H,6-15H2,(H,25,26)/t17?,20?,21?,22-/m0/s1.
What are the key properties of (3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide?
(3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide has a molecular weight of 356.49 g/mol, XLogP of 3.34, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-(fluoromethyl)-3-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-1-carboxamide is sourced from PubChem (CID 166908966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).