About methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate
methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate (PubChem CID 166908989) has the molecular formula C24H30N2O3
and a molecular weight of 394.52 g/mol. Its IUPAC name is methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate.
Molecular Properties
| Compound Name | methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate |
| PubChem CID | 166908989 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate |
| SMILES | COC(=O)C12CC3CC(c4ccccc4)(CC1(C(=O)N=C1CCC(N)CC1)C3)C2 |
| InChI | InChI=1S/C24H30N2O3/c1-29-21(28)24-13-16-11-22(15-24,17-5-3-2-4-6-17)14-23(24,12-16)20(27)26-19-9-7-18(25)8-10-19/h2-6,16,18H,7-15,25H2,1H3/b26-19- |
| InChIKey | IYCDBFBJRPDNNI-XHPQRKPJSA-N |
| XLogP | 3.55 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate?
The IUPAC name of methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate (CID 166908989) is methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate.
What is the SMILES notation for methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate?
The canonical SMILES for methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate is COC(=O)C12CC3CC(c4ccccc4)(CC1(C(=O)N=C1CCC(N)CC1)C3)C2.
What is the InChIKey of methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate?
The InChIKey is IYCDBFBJRPDNNI-XHPQRKPJSA-N. The full InChI is InChI=1S/C24H30N2O3/c1-29-21(28)24-13-16-11-22(15-24,17-5-3-2-4-6-17)14-23(24,12-16)20(27)26-19-9-7-18(25)8-10-19/h2-6,16,18H,7-15,25H2,1H3/b26-19-.
What are the key properties of methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate?
methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate has a molecular weight of 394.52 g/mol, XLogP of 3.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(4-aminocyclohexylidene)carbamoyl]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylate is sourced from PubChem (CID 166908989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).