C18H18F3NO — CID 166908993
(6Z)-1-phenyl-6-(2,2,2-trifluoroethylidene)tricyclo[3.3.1.03,7]nonane-3-carboxamide (PubChem CID 166908993) has the molecular formula C18H18F3NO and a molecular weight of 321.34 g/mol. Its IUPAC name is (6Z)-1-phenyl-6-(2,2,2-trifluoroethylidene)tricyclo[3.3.1.03,7]nonane-3-carboxamide.
| Compound Name | (6Z)-1-phenyl-6-(2,2,2-trifluoroethylidene)tricyclo[3.3.1.03,7]nonane-3-carboxamide |
|---|---|
| PubChem CID | 166908993 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (6Z)-1-phenyl-6-(2,2,2-trifluoroethylidene)tricyclo[3.3.1.03,7]nonane-3-carboxamide |
| SMILES | NC(=O)C12CC3CC(c4ccccc4)(CC1/C3=C\C(F)(F)F)C2 |
| InChI | InChI=1S/C18H18F3NO/c19-18(20,21)8-13-11-6-16(12-4-2-1-3-5-12)9-14(13)17(7-11,10-16)15(22)23/h1-5,8,11,14H,6-7,9-10H2,(H2,22,23)/b13-8- |
| InChIKey | QVFYGYZRWHCWME-JYRVWZFOSA-N |
| XLogP | 3.72 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|