About (4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine
(4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine (PubChem CID 166909191) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is (4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine.
Molecular Properties
| Compound Name | (4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine |
| PubChem CID | 166909191 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine |
| SMILES | C=C(CC)/C(N)=C\C(=C/C)CC |
| InChI | InChI=1S/C11H19N/c1-5-9(4)11(12)8-10(6-2)7-3/h6,8H,4-5,7,12H2,1-3H3/b10-6-,11-8+ |
| InChIKey | MTMWZAFTZIQAQU-YANFREPOSA-N |
| XLogP | 3.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine?
The IUPAC name of (4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine (CID 166909191) is (4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine.
What is the SMILES notation for (4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine?
The canonical SMILES for (4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine is C=C(CC)/C(N)=C\C(=C/C)CC.
What is the InChIKey of (4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine?
The InChIKey is MTMWZAFTZIQAQU-YANFREPOSA-N. The full InChI is InChI=1S/C11H19N/c1-5-9(4)11(12)8-10(6-2)7-3/h6,8H,4-5,7,12H2,1-3H3/b10-6-,11-8+.
What are the key properties of (4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine?
(4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine has a molecular weight of 165.28 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,6Z)-6-ethyl-3-methylideneocta-4,6-dien-4-amine is sourced from PubChem (CID 166909191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).