About 5-methylazepine-3,4,5-triamine
5-methylazepine-3,4,5-triamine (PubChem CID 166909681) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 5-methylazepine-3,4,5-triamine.
Molecular Properties
| Compound Name | 5-methylazepine-3,4,5-triamine |
| PubChem CID | 166909681 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 5-methylazepine-3,4,5-triamine |
| SMILES | CC1(N)C=CN=CC(N)=C1N |
| InChI | InChI=1S/C7H12N4/c1-7(10)2-3-11-4-5(8)6(7)9/h2-4H,8-10H2,1H3 |
| InChIKey | BCJFVHLZICMTPF-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methylazepine-3,4,5-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylazepine-3,4,5-triamine?
The IUPAC name of 5-methylazepine-3,4,5-triamine (CID 166909681) is 5-methylazepine-3,4,5-triamine.
What is the SMILES notation for 5-methylazepine-3,4,5-triamine?
The canonical SMILES for 5-methylazepine-3,4,5-triamine is CC1(N)C=CN=CC(N)=C1N.
What is the InChIKey of 5-methylazepine-3,4,5-triamine?
The InChIKey is BCJFVHLZICMTPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-7(10)2-3-11-4-5(8)6(7)9/h2-4H,8-10H2,1H3.
What are the key properties of 5-methylazepine-3,4,5-triamine?
5-methylazepine-3,4,5-triamine has a molecular weight of 152.20 g/mol, XLogP of -0.57, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylazepine-3,4,5-triamine is sourced from PubChem (CID 166909681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).