C32H28N2O6S2 — CID 166909825
(2E)-2-[1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]sulfonyl-3-oxoindol-2-ylidene]-1-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]sulfonylindol-3-one (PubChem CID 166909825) has the molecular formula C32H28N2O6S2 and a molecular weight of 600.72 g/mol. Its IUPAC name is (2E)-2-[1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]sulfonyl-3-oxoindol-2-ylidene]-1-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]sulfonylindol-3-one.
| Compound Name | (2E)-2-[1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]sulfonyl-3-oxoindol-2-ylidene]-1-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]sulfonylindol-3-one |
|---|---|
| PubChem CID | 166909825 |
| Molecular Formula | C32H28N2O6S2 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | (2E)-2-[1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]sulfonyl-3-oxoindol-2-ylidene]-1-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]sulfonylindol-3-one |
| SMILES | C=C/C=C\C(=C/C=C)S(=O)(=O)N1/C(=C2\C(=O)c3ccccc3N2S(=O)(=O)C(/C=C\C)=C/C=C\C)C(=O)c2ccccc21 |
| InChI | InChI=1S/C32H28N2O6S2/c1-5-9-17-23(15-7-3)41(37,38)33-27-21-13-11-19-25(27)31(35)29(33)30-32(36)26-20-12-14-22-28(26)34(30)42(39,40)24(16-8-4)18-10-6-2/h5-22H,1,3H2,2,4H3/b10-6-,16-8-,17-9-,23-15+,24-18+,30-29+ |
| InChIKey | JDUARJYKRVLWMM-WBRIIUIFSA-N |
| XLogP | 6.11 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_E(44)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|