C19H19N3O2S — CID 166910120
6-[(E)-[methyl-(5-methyl-4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]cyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 166910120) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 6-[(E)-[methyl-(5-methyl-4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]cyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 6-[(E)-[methyl-(5-methyl-4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]cyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 166910120 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 6-[(E)-[methyl-(5-methyl-4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]cyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | Cc1sc(N(C)/N=C/C2=CCCC=C2C(=O)O)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H19N3O2S/c1-13-17(14-8-4-3-5-9-14)21-19(25-13)22(2)20-12-15-10-6-7-11-16(15)18(23)24/h3-5,8-12H,6-7H2,1-2H3,(H,23,24)/b20-12+ |
| InChIKey | JQXOKPJAQFNNSD-UDWIEESQSA-N |
| XLogP | 4.27 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|