C28H28FN5O3S — CID 166910416
2-(5-fluoro-2-hydroxyphenyl)-2-[(1-formyl-6-piperazin-1-ylnaphthalen-2-yl)methyl-methylamino]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 166910416) has the molecular formula C28H28FN5O3S and a molecular weight of 533.63 g/mol. Its IUPAC name is 2-(5-fluoro-2-hydroxyphenyl)-2-[(1-formyl-6-piperazin-1-ylnaphthalen-2-yl)methyl-methylamino]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(5-fluoro-2-hydroxyphenyl)-2-[(1-formyl-6-piperazin-1-ylnaphthalen-2-yl)methyl-methylamino]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 166910416 |
| Molecular Formula | C28H28FN5O3S |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 2-(5-fluoro-2-hydroxyphenyl)-2-[(1-formyl-6-piperazin-1-ylnaphthalen-2-yl)methyl-methylamino]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CN(Cc1ccc2cc(N3CCNCC3)ccc2c1C=O)C(C(=O)Nc1nccs1)c1cc(F)ccc1O |
| InChI | InChI=1S/C28H28FN5O3S/c1-33(26(23-15-20(29)4-7-25(23)36)27(37)32-28-31-10-13-38-28)16-19-3-2-18-14-21(34-11-8-30-9-12-34)5-6-22(18)24(19)17-35/h2-7,10,13-15,17,26,30,36H,8-9,11-12,16H2,1H3,(H,31,32,37) |
| InChIKey | GVIFWAVCPNLZCC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|