About 4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole
4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole (PubChem CID 166911894) has the molecular formula C19H26N4O2S
and a molecular weight of 374.51 g/mol. Its IUPAC name is 4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole.
Molecular Properties
| Compound Name | 4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole |
| PubChem CID | 166911894 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole |
| SMILES | CC(C)Cn1cc(CCNS(=O)N(C)C)c2ccc(-c3cnoc3)cc21 |
| InChI | InChI=1S/C19H26N4O2S/c1-14(2)11-23-12-16(7-8-21-26(24)22(3)4)18-6-5-15(9-19(18)23)17-10-20-25-13-17/h5-6,9-10,12-14,21H,7-8,11H2,1-4H3 |
| InChIKey | XJAYLPQMVLSFCD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole?
The IUPAC name of 4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole (CID 166911894) is 4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole.
What is the SMILES notation for 4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole?
The canonical SMILES for 4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole is CC(C)Cn1cc(CCNS(=O)N(C)C)c2ccc(-c3cnoc3)cc21.
What is the InChIKey of 4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole?
The InChIKey is XJAYLPQMVLSFCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4O2S/c1-14(2)11-23-12-16(7-8-21-26(24)22(3)4)18-6-5-15(9-19(18)23)17-10-20-25-13-17/h5-6,9-10,12-14,21H,7-8,11H2,1-4H3.
What are the key properties of 4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole?
4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole has a molecular weight of 374.51 g/mol, XLogP of 3.22, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[2-(dimethylsulfinamoylamino)ethyl]-1-(2-methylpropyl)indol-6-yl]-1,2-oxazole is sourced from PubChem (CID 166911894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).